cas: 1270084-92-8 — see every product listed under this CAS number, including other names
APX-115 (free base), 99.54% (CAS 1270084-92-8) is a chemical reagent available from Chemat. Available pack sizes: 50 mg, 25 mg, 10 mg, 10mM/1mL, 5 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-120801A-50 mg |
| cas | 1270084-92-8 |
| size | 50 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 mg | 3380.09 Pln | |
| MedChemExpress | 25 mg | 2135.50 Pln | |
| MedChemExpress | 10 mg | 1081.31 Pln | |
| MedChemExpress | 10mM/1mL | 858.40 Pln | |
| MedChemExpress | 5 mg | 695.86 Pln | |
| MedChemExpress | 100 mg | 5395.58 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.54% |
5-phenyl-4-propyl-2-pyridin-2-yl-1H-pyrazol-3-one (CAS 1270084-92-8) is a chemical compound with the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. IUPAC name: 5-phenyl-4-propyl-2-pyridin-2-yl-1H-pyrazol-3-one. InChIKey: GIWZEELPLKPYBA-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O |
|---|---|
| Molecular weight | 279.34 g/mol |
| IUPAC name | 5-phenyl-4-propyl-2-pyridin-2-yl-1H-pyrazol-3-one |
| InChIKey | GIWZEELPLKPYBA-UHFFFAOYSA-N |
| SMILES | CCCC1=C(NN(C1=O)C2=CC=CC=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)