CAS 1134203-12-5 appears in our catalog under these names: ATPase–IN–3, ATPase-IN-3/ 97.76% (existing batch purity), ATPase-IN-3, ATPase-IN-3, 99.89%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg.
(5Z)-5-[(3-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 1134203-12-5) is a chemical compound with the molecular formula C10H6N2O3S2 and a molecular weight of 266.3 g/mol. IUPAC name: (5Z)-5-[(3-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: AVXJAQDWWJILLN-YVMONPNESA-N.
| Molecular formula | C10H6N2O3S2 |
|---|---|
| Molecular weight | 266.3 g/mol |
| IUPAC name | (5Z)-5-[(3-nitrophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | AVXJAQDWWJILLN-YVMONPNESA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])/C=C\2/C(=O)NC(=S)S2 |
Computed by PubChem (NCBI)