cas: 19542-77-9 — see every product listed under this CAS number, including other names
Ac-Cys(Bzl)-OH, 99.72% (CAS 19542-77-9) is a chemical reagent available from Chemat. Available pack sizes: 250 mg, 500 mg, 10 g, 100 mg, 5 g, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W101367-250 mg |
| cas | 19542-77-9 |
| size | 250 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 250 mg | 445.08 Pln | |
| MedChemExpress | 500 mg | 551.89 Pln | |
| MedChemExpress | 10 g | 2520.95 Pln | |
| MedChemExpress | 100 mg | 310.40 Pln | |
| MedChemExpress | 5 g | 1629.30 Pln | |
| MedChemExpress | 1 g | 742.30 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.72% |
(2R)-2-acetamido-3-benzylsulfanylpropanoic acid (CAS 19542-77-9) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: (2R)-2-acetamido-3-benzylsulfanylpropanoic acid. InChIKey: BJUXDERNWYKSIQ-NSHDSACASA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | (2R)-2-acetamido-3-benzylsulfanylpropanoic acid |
| InChIKey | BJUXDERNWYKSIQ-NSHDSACASA-N |
| SMILES | CC(=O)N[C@@H](CSCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)