cas: 19542-77-9 — see every product listed under this CAS number, including other names
N–Acetyl–S–benzyl–L–cysteine (CAS 19542-77-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB60044-100 |
| cas | 19542-77-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 601.72 Pln | |
| GLPBio | 1g | 1256.99 Pln | |
| GLPBio | 250mg | 732.77 Pln | |
| GLPBio | 5g | 2726.67 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-2-acetamido-3-benzylsulfanylpropanoic acid (CAS 19542-77-9) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: (2R)-2-acetamido-3-benzylsulfanylpropanoic acid. InChIKey: BJUXDERNWYKSIQ-NSHDSACASA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | (2R)-2-acetamido-3-benzylsulfanylpropanoic acid |
| InChIKey | BJUXDERNWYKSIQ-NSHDSACASA-N |
| SMILES | CC(=O)N[C@@H](CSCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)