Ac-Glu(OtBu)-OH 98%
cas: 84192-88-1 — see every product listed under this CAS number, including other names
Ac-Glu(OtBu)-OH 98% (CAS 84192-88-1) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A120632-1000g |
| cas | 84192-88-1 |
| size | 1000g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 18142.56 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1021.19 Pln | |
| Ambeed | 100g | 3257.31 Pln | |
| Ambeed | 500g | 11361.88 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A120632 |
(2S)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 84192-88-1) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2S)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: FALCCLKESWGSNI-QMMMGPOBSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2S)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | FALCCLKESWGSNI-QMMMGPOBSA-N |
| SMILES | CC(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Ac-Glu(OtBu)-OH, (S)-2-Acetamido-5-(tert-butoxy)-5-oxopentanoic acid, (2S)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid, Acetyl-L-glutamic acid beta-tert-butyl ester, (S)-2-acetamido-5-tert-butoxy-5-oxopentanoic acid, (S)-2-Acetamido-5-(tert-butoxy)-5, N-Acetyl-L-glutamate 5-tert-Butyl Ester, (2S)-2-acetamido-5-tert-butoxy-5-oxo-pentanoic acid, (2S)-2-Acetamido-5-tert-butoxy-5-oxopentanoic acid