Ac-Glu(OtBu)-OH, 98%
cas: 84192-88-1 — see every product listed under this CAS number, including other names
Ac-Glu(OtBu)-OH, 98% (CAS 84192-88-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03130-250MG |
| cas | 84192-88-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 445.69 Pln | |
| Fluorochem | 25g | 810.15 Pln | |
| Fluorochem | 100g | 2372.10 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 84192-88-1) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: (2S)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: FALCCLKESWGSNI-QMMMGPOBSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | (2S)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | FALCCLKESWGSNI-QMMMGPOBSA-N |
| SMILES | CC(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Ac-Glu(OtBu)-OH, (S)-2-Acetamido-5-(tert-butoxy)-5-oxopentanoic acid, (2S)-2-acetamido-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid, Acetyl-L-glutamic acid beta-tert-butyl ester, (S)-2-acetamido-5-tert-butoxy-5-oxopentanoic acid, (S)-2-Acetamido-5-(tert-butoxy)-5, N-Acetyl-L-glutamate 5-tert-Butyl Ester, (2S)-2-acetamido-5-tert-butoxy-5-oxo-pentanoic acid, (2S)-2-Acetamido-5-tert-butoxy-5-oxopentanoic acid