Products 79620-28-3
CAS 79620-28-3 appears in our catalog under these names: Amberlite? IRC–748, Amberlite|r IRC-748, ion exchange resin , Amberlite IRC 718. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 100g, 250g, 50g, 1000g, 1kg.
(1R,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 79620-28-3) is a chemical compound with the molecular formula C17H18Cl3N and a molecular weight of 342.7 g/mol. IUPAC name: (1R,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: BLFQGGGGFNSJKA-LWHGMNCYSA-N.
| Molecular formula | C17H18Cl3N |
|---|---|
| Molecular weight | 342.7 g/mol |
| IUPAC name | (1R,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | BLFQGGGGFNSJKA-LWHGMNCYSA-N |
| SMILES | CN[C@@H]1CC[C@H](C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl.Cl |
Computed by PubChem (NCBI)