CAS 1330180-66-9 appears in our catalog under these names: (±)-trans-Sertraline-d3 HCl (N-methyl-d3), 99 atom % D, min 98% Chemical Purity, rac-trans Sertraline-d3 Hydrochloride, >95% (HPLC), rel–Sertraline–d3 hydrochloride, rel-Sertraline-d3 (hydrochloride). Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 10mg, 1mg, 1 mg.
(1S,4R)-4-(3,4-dichlorophenyl)-N-(trideuteriomethyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 1330180-66-9) is a chemical compound with the molecular formula C17H18Cl3N and a molecular weight of 345.7 g/mol. IUPAC name: (1S,4R)-4-(3,4-dichlorophenyl)-N-(trideuteriomethyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: BLFQGGGGFNSJKA-KSGPAQBCSA-N.
| Molecular formula | C17H18Cl3N |
|---|---|
| Molecular weight | 345.7 g/mol |
| IUPAC name | (1S,4R)-4-(3,4-dichlorophenyl)-N-(trideuteriomethyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | BLFQGGGGFNSJKA-KSGPAQBCSA-N |
| SMILES | [2H]C([2H])([2H])N[C@H]1CC[C@@H](C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl.Cl |
Computed by PubChem (NCBI)