CAS 79645-15-1 appears in our catalog under these names: Sertraline EP Impurity G HCl, (1R,4R)-4-(3,4-Dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 98%, (R,R)-Sertraline Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
(1R,4R)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 79645-15-1) is a chemical compound with the molecular formula C17H18Cl3N and a molecular weight of 342.7 g/mol. IUPAC name: (1R,4R)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: BLFQGGGGFNSJKA-JSUROZADSA-N.
| Molecular formula | C17H18Cl3N |
|---|---|
| Molecular weight | 342.7 g/mol |
| IUPAC name | (1R,4R)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | BLFQGGGGFNSJKA-JSUROZADSA-N |
| SMILES | CN[C@@H]1CC[C@@H](C2=CC=CC=C12)C3=CC(=C(C=C3)Cl)Cl.Cl |
Computed by PubChem (NCBI)