CAS 1198084-29-5 appears in our catalog under these names: Sertraline 2,3-Dichloro Isomer, Sertraline Impurity 10(Sertraline 2,3-Dichloro Isomer), rac-cis-2,3-Dichloro Sertraline Hydrochloride, >95% (HPLC), rac-cis-2,3-dichloro sertraline hydrochloride, Sertraline impurity 3. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, Get quote.
(1S,4R)-4-(2,3-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 1198084-29-5) is a chemical compound with the molecular formula C17H18Cl3N and a molecular weight of 342.7 g/mol. IUPAC name: (1S,4R)-4-(2,3-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: LDIZHWJFDILCKL-KKJWGQAZSA-N.
| Molecular formula | C17H18Cl3N |
|---|---|
| Molecular weight | 342.7 g/mol |
| IUPAC name | (1S,4R)-4-(2,3-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | LDIZHWJFDILCKL-KKJWGQAZSA-N |
| SMILES | CN[C@H]1CC[C@H](C2=CC=CC=C12)C3=C(C(=CC=C3)Cl)Cl.Cl |
Computed by PubChem (NCBI)