CAS 14932-25-3 is the registry number for Amino-BCheptane-COOH*HCl (S,R,S,R/R,S,R,S). Offered by: Iris Biotech. Available pack sizes: 1g.
(1S,2R,3S,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid;hydrochloride (CAS 14932-25-3) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: (1S,2R,3S,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid;hydrochloride. InChIKey: GVGHCTZKPYWADE-MBWJBUSCSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | (1S,2R,3S,4R)-3-aminobicyclo[2.2.1]heptane-2-carboxylic acid;hydrochloride |
| InChIKey | GVGHCTZKPYWADE-MBWJBUSCSA-N |
| SMILES | C1C[C@@H]2C[C@H]1[C@H]([C@H]2N)C(=O)O.Cl |
Computed by PubChem (NCBI)