Aminotadalafil, 99%
cas: 385769-84-6 — see every product listed under this CAS number, including other names
Aminotadalafil, 99% (CAS 385769-84-6) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C7XC-5mg |
| cas | 385769-84-6 |
| size | 5mg |
| availability | 125g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 88.40 Pln | |
| Chemat | 10mg | 93.20 Pln | |
| Chemat | 25mg | 98.00 Pln | |
| Chemat | 50mg | 107.60 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 472.40 Pln | |
| Chemat | 10g | 755.60 Pln | |
| Chemat | 25g | 1446.80 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2R,8R)-6-amino-2-(1,3-benzodioxol-5-yl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (CAS 385769-84-6) is a chemical compound with the molecular formula C21H18N4O4 and a molecular weight of 390.4 g/mol. IUPAC name: (2R,8R)-6-amino-2-(1,3-benzodioxol-5-yl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione. InChIKey: VUKJGAVIWMPOOJ-FOIQADDNSA-N.
| Molecular formula | C21H18N4O4 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | (2R,8R)-6-amino-2-(1,3-benzodioxol-5-yl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| InChIKey | VUKJGAVIWMPOOJ-FOIQADDNSA-N |
| SMILES | C1[C@@H]2C(=O)N(CC(=O)N2[C@@H](C3=C1C4=CC=CC=C4N3)C5=CC6=C(C=C5)OCO6)N |
Computed by PubChem (NCBI)