CAS 1533432-50-6 appears in our catalog under these names: tert-Butyl 7-(6-nitropyridin-3-yl)-5H-pyrido[4,3-b]indole-5-carboxylate, 97%, 97%, TERT-BUTYL 7-(6-NITROPYRIDIN-3-YL)-5H-PYRIDO[4,3-B]INDOLE-5-CARBOXYLATE, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
Tert-butyl 7-(6-nitro-3-pyridinyl)pyrido[4,3-b]indole-5-carboxylate (CAS 1533432-50-6) is a chemical compound with the molecular formula C21H18N4O4 and a molecular weight of 390.4 g/mol. IUPAC name: tert-butyl 7-(6-nitro-3-pyridinyl)pyrido[4,3-b]indole-5-carboxylate. InChIKey: ISMSBSWTELQKON-UHFFFAOYSA-N.
| Molecular formula | C21H18N4O4 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | tert-butyl 7-(6-nitro-3-pyridinyl)pyrido[4,3-b]indole-5-carboxylate |
| InChIKey | ISMSBSWTELQKON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=NC=C2)C3=C1C=C(C=C3)C4=CN=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)