Products 1511834-90-4
CAS 1511834-90-4 is the registry number for 1-(1-{((9H-Fluoren-9-yl)methoxy)carbonyl}azetidin-3-yl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[1-(9H-fluoren-9-ylmethoxycarbonyl)azetidin-3-yl]triazole-4-carboxylic acid (CAS 1511834-90-4) is a chemical compound with the molecular formula C21H18N4O4 and a molecular weight of 390.4 g/mol. IUPAC name: 1-[1-(9H-fluoren-9-ylmethoxycarbonyl)azetidin-3-yl]triazole-4-carboxylic acid. InChIKey: VBUVQKCBQJHALG-UHFFFAOYSA-N.
| Molecular formula | C21H18N4O4 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 1-[1-(9H-fluoren-9-ylmethoxycarbonyl)azetidin-3-yl]triazole-4-carboxylic acid |
| InChIKey | VBUVQKCBQJHALG-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)N5C=C(N=N5)C(=O)O |
Computed by PubChem (NCBI)