cas: 69408-81-7 — see every product listed under this CAS number, including other names
Amonafide, 98%, 98% (CAS 69408-81-7) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116ZRF-1mg |
| cas | 69408-81-7 |
| size | 1mg |
| availability | 14g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 170.00 Pln | |
| Chemat | 5mg | 194.00 Pln | |
| Chemat | 10mg | 242.00 Pln | |
| Chemat | 50mg | 510.80 Pln | |
| Chemat | 100mg | 894.80 Pln | |
| Chemat | 250mg | 1058.00 Pln | |
| Chemat | 500mg | 1802.00 Pln | |
| Chemat | 1g | 3290.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-amino-2-[2-(dimethylamino)ethyl]benzo[de]isoquinoline-1,3-dione (CAS 69408-81-7) is a chemical compound with the molecular formula C16H17N3O2 and a molecular weight of 283.32 g/mol. IUPAC name: 5-amino-2-[2-(dimethylamino)ethyl]benzo[de]isoquinoline-1,3-dione. InChIKey: UPALIKSFLSVKIS-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O2 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 5-amino-2-[2-(dimethylamino)ethyl]benzo[de]isoquinoline-1,3-dione |
| InChIKey | UPALIKSFLSVKIS-UHFFFAOYSA-N |
| SMILES | CN(C)CCN1C(=O)C2=CC=CC3=CC(=CC(=C32)C1=O)N |
Computed by PubChem (NCBI)