CAS 1020054-02-7 is the registry number for N-{4-[Acetyl(methyl)amino]phenyl}-3-aminobenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-[acetyl(methyl)amino]phenyl]-3-aminobenzamide (CAS 1020054-02-7) is a chemical compound with the molecular formula C16H17N3O2 and a molecular weight of 283.32 g/mol. IUPAC name: N-[4-[acetyl(methyl)amino]phenyl]-3-aminobenzamide. InChIKey: LYHFJUSNHFDHJA-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O2 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | N-[4-[acetyl(methyl)amino]phenyl]-3-aminobenzamide |
| InChIKey | LYHFJUSNHFDHJA-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)C1=CC=C(C=C1)NC(=O)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)