Products 904816-46-2
CAS 904816-46-2 is the registry number for 6-(3-Phenylpiperazin-1-yl)nicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
6-(3-phenylpiperazin-1-yl)pyridine-3-carboxylic acid (CAS 904816-46-2) is a chemical compound with the molecular formula C16H17N3O2 and a molecular weight of 283.32 g/mol. IUPAC name: 6-(3-phenylpiperazin-1-yl)pyridine-3-carboxylic acid. InChIKey: XQZPMWAWYUHYSA-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O2 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 6-(3-phenylpiperazin-1-yl)pyridine-3-carboxylic acid |
| InChIKey | XQZPMWAWYUHYSA-UHFFFAOYSA-N |
| SMILES | C1CN(CC(N1)C2=CC=CC=C2)C3=NC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)