CAS 2451927-94-7 appears in our catalog under these names: Omeprazole Impurity 51, 2-((3,5-Dimethyl-2-pyridinyl)methoxy)-6-methoxy-1H-benzimidazole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
2-[(3,5-dimethyl-2-pyridinyl)methoxy]-6-methoxy-1H-benzimidazole (CAS 2451927-94-7) is a chemical compound with the molecular formula C16H17N3O2 and a molecular weight of 283.32 g/mol. IUPAC name: 2-[(3,5-dimethyl-2-pyridinyl)methoxy]-6-methoxy-1H-benzimidazole. InChIKey: AGYUWWGSTHVRBB-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O2 |
|---|---|
| Molecular weight | 283.32 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-2-pyridinyl)methoxy]-6-methoxy-1H-benzimidazole |
| InChIKey | AGYUWWGSTHVRBB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)COC2=NC3=C(N2)C=C(C=C3)OC)C |
Computed by PubChem (NCBI)