cas: 377085-56-8 — see every product listed under this CAS number, including other names
Amyl 4-Carboxyphenyl Carbonate, ≥96%(T), ≥96%(T) (CAS 377085-56-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8FJ-250mg |
| cas | 377085-56-8 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1619.60 Pln |
| purity | ≥96%(T) |
|---|---|
| delivery time | 3 weeks |
4-pentoxycarbonyloxybenzoic acid (CAS 377085-56-8) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: 4-pentoxycarbonyloxybenzoic acid. InChIKey: RMIZZENBDILCRU-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 4-pentoxycarbonyloxybenzoic acid |
| InChIKey | RMIZZENBDILCRU-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)OC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)