CAS 145361-91-7 is the registry number for tert-Butyl 4-formyl-2-methoxyphenyl carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Tert-butyl (4-formyl-2-methoxyphenyl) carbonate (CAS 145361-91-7) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: tert-butyl (4-formyl-2-methoxyphenyl) carbonate. InChIKey: QHWDRZQSXVKLON-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | tert-butyl (4-formyl-2-methoxyphenyl) carbonate |
| InChIKey | QHWDRZQSXVKLON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=C(C=C(C=C1)C=O)OC |
Computed by PubChem (NCBI)