Products 145361-91-7

CAS 145361-91-7 is the registry number for tert-Butyl 4-formyl-2-methoxyphenyl carbonate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl (4-formyl-2-methoxyphenyl) carbonate (CAS 145361-91-7) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: tert-butyl (4-formyl-2-methoxyphenyl) carbonate. InChIKey: QHWDRZQSXVKLON-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O5
Molecular weight252.26 g/mol
IUPAC nametert-butyl (4-formyl-2-methoxyphenyl) carbonate
InChIKeyQHWDRZQSXVKLON-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)OC1=C(C=C(C=C1)C=O)OC

Computed by PubChem (NCBI)