Products 377085-56-8
CAS 377085-56-8 appears in our catalog under these names: Amyl 4-carboxyphenyl carbonate, 95%, Amyl 4–Carboxyphenyl Carbonate, Amyl 4-Carboxyphenyl Carbonate, >98.0%(T)(GC), Amyl 4-Carboxyphenyl Carbonate, ≥96%(T), ≥96%(T), 4-(((Pentyloxy)carbonyl)oxy)benzoic acid. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 250mg.
4-pentoxycarbonyloxybenzoic acid (CAS 377085-56-8) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: 4-pentoxycarbonyloxybenzoic acid. InChIKey: RMIZZENBDILCRU-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 4-pentoxycarbonyloxybenzoic acid |
| InChIKey | RMIZZENBDILCRU-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)OC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)