CAS 4378-55-6 appears in our catalog under these names: 5-(3,4-Dimethoxyphenyl)-5-oxovaleric acid, 95%, 5–(3,4–Dimethoxyphenyl)–5–oxovaleric acid, 5-(3,4-Dimethoxyphenyl)-5-oxovaleric acid, 98%, 98%, 5-(3,4-Dimethoxyphenyl)-5-oxovaleric acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 500mg, 2.5g.
5-(3,4-dimethoxyphenyl)-5-oxopentanoic acid (CAS 4378-55-6) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-5-oxopentanoic acid. InChIKey: VCPFAIMGNLXMPO-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-5-oxopentanoic acid |
| InChIKey | VCPFAIMGNLXMPO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CCCC(=O)O)OC |
Computed by PubChem (NCBI)