Products 2426686-17-9
CAS 2426686-17-9 appears in our catalog under these names: Anticancer agent 46/ 97.08% (existing batch purity), Anticancer agent 46, Anticancer agent 46 95%, Anticancer agent 46, 95%, 95%, Anticancer agent 46, 95.73%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 100 mg, 50 mg, 5 mg.
1-[(E)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-3-phenylthiourea (CAS 2426686-17-9) is a chemical compound with the molecular formula C15H14ClN3OS and a molecular weight of 319.8 g/mol. IUPAC name: 1-[(E)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-3-phenylthiourea. InChIKey: RULWGWSLXXARKC-VCHYOVAHSA-N.
| Molecular formula | C15H14ClN3OS |
|---|---|
| Molecular weight | 319.8 g/mol |
| IUPAC name | 1-[(E)-1-(5-chloro-2-hydroxyphenyl)ethylideneamino]-3-phenylthiourea |
| InChIKey | RULWGWSLXXARKC-VCHYOVAHSA-N |
| SMILES | C/C(=N\NC(=S)NC1=CC=CC=C1)/C2=C(C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)