cas: 160707-69-7 — see every product listed under this CAS number, including other names
Apricitabine, 95+% (CAS 160707-69-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A489709-250mg |
| cas | 160707-69-7 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 5063.17 Pln | |
| AmBeed | 100mg | 2569.84 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-amino-1-[(2R,4R)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]pyrimidin-2-one (CAS 160707-69-7) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. IUPAC name: 4-amino-1-[(2R,4R)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]pyrimidin-2-one. InChIKey: RYMCFYKJDVMSIR-RNFRBKRXSA-N.
| Molecular formula | C8H11N3O3S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 4-amino-1-[(2R,4R)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]pyrimidin-2-one |
| InChIKey | RYMCFYKJDVMSIR-RNFRBKRXSA-N |
| SMILES | C1[C@@H](S[C@@H](O1)CO)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)