CAS 143338-13-0 is the registry number for Trans-2'-deoxy-3'-oxa-4'-thiocytidine (apricitabine). Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
4-amino-1-[(2R,4S)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]pyrimidin-2-one (CAS 143338-13-0) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. IUPAC name: 4-amino-1-[(2R,4S)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]pyrimidin-2-one. InChIKey: RYMCFYKJDVMSIR-NKWVEPMBSA-N.
| Molecular formula | C8H11N3O3S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 4-amino-1-[(2R,4S)-2-(hydroxymethyl)-1,3-oxathiolan-4-yl]pyrimidin-2-one |
| InChIKey | RYMCFYKJDVMSIR-NKWVEPMBSA-N |
| SMILES | C1[C@H](S[C@@H](O1)CO)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)