Products 25274-27-5
CAS 25274-27-5 appears in our catalog under these names: Aristolone/ 99.92% (existing batch purity), Aristolone, (-)-Aristolone, 97%, 97%, Aristolone, 99.38%, ARISTOLONE, 97%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 20mg, 5mg, 2mg, 10mg, 25mg, 50mg, 1mg, 100mg.
(1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one (CAS 25274-27-5) is a chemical compound with the molecular formula C15H22O and a molecular weight of 218.33 g/mol. IUPAC name: (1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one. InChIKey: UGVIZCBJCSXBCJ-JWFUOXDNSA-N.
| Molecular formula | C15H22O |
|---|---|
| Molecular weight | 218.33 g/mol |
| IUPAC name | (1aR,7R,7aR,7bS)-1,1,7,7a-tetramethyl-1a,4,5,6,7,7b-hexahydrocyclopropa[a]naphthalen-2-one |
| InChIKey | UGVIZCBJCSXBCJ-JWFUOXDNSA-N |
| SMILES | C[C@@H]1CCCC2=CC(=O)[C@@H]3[C@H]([C@@]12C)C3(C)C |
Computed by PubChem (NCBI)