CAS 1033767-86-0 appears in our catalog under these names: BAY–474, BAY-474/ 99.89% (existing batch purity), BAY-474, BAY-474 99%, 2,6-Dimethyl-4-(3-methyl-1H-indazol-5-yl)-1,4-dihydropyridine-3,5-dicarbonitrile, 99%, 99%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 200mg, 250mg.
2,6-dimethyl-4-(3-methyl-2H-indazol-5-yl)-1,4-dihydropyridine-3,5-dicarbonitrile (CAS 1033767-86-0) is a chemical compound with the molecular formula C17H15N5 and a molecular weight of 289.33 g/mol. IUPAC name: 2,6-dimethyl-4-(3-methyl-2H-indazol-5-yl)-1,4-dihydropyridine-3,5-dicarbonitrile. InChIKey: QKVFMAAIXZONRN-UHFFFAOYSA-N.
| Molecular formula | C17H15N5 |
|---|---|
| Molecular weight | 289.33 g/mol |
| IUPAC name | 2,6-dimethyl-4-(3-methyl-2H-indazol-5-yl)-1,4-dihydropyridine-3,5-dicarbonitrile |
| InChIKey | QKVFMAAIXZONRN-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C=CC2=NN1)C3C(=C(NC(=C3C#N)C)C)C#N |
Computed by PubChem (NCBI)