Products 207732-11-4
CAS 207732-11-4 appears in our catalog under these names: BB-78485/ 99.49% (existing batch purity), BB 78485, BB-78485. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
(2R)-N-hydroxy-3-naphthalen-2-yl-2-(naphthalen-2-ylsulfonylamino)propanamide (CAS 207732-11-4) is a chemical compound with the molecular formula C23H20N2O4S and a molecular weight of 420.5 g/mol. IUPAC name: (2R)-N-hydroxy-3-naphthalen-2-yl-2-(naphthalen-2-ylsulfonylamino)propanamide. InChIKey: MMOUXLMPQFMDRD-JOCHJYFZSA-N.
| Molecular formula | C23H20N2O4S |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | (2R)-N-hydroxy-3-naphthalen-2-yl-2-(naphthalen-2-ylsulfonylamino)propanamide |
| InChIKey | MMOUXLMPQFMDRD-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C[C@H](C(=O)NO)NS(=O)(=O)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)