cas: 979-88-4 — see every product listed under this CAS number, including other names
BCA, 97% (CAS 979-88-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987628-5G |
| cas | 979-88-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 200.99 Pln | |
| Fluorochem | 25g | 315.53 Pln | |
| Fluorochem | 100g | 825.77 Pln | |
| Fluorochem | 500g | 3205.14 Pln | |
| Fluorochem | 1kg | 6360.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate (CAS 979-88-4) is a chemical compound with the molecular formula C20H10N2Na2O4 and a molecular weight of 388.3 g/mol. IUPAC name: disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate. InChIKey: AUPXFICLXPLHBB-UHFFFAOYSA-L.
| Molecular formula | C20H10N2Na2O4 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate |
| InChIKey | AUPXFICLXPLHBB-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=NC4=CC=CC=C4C(=C3)C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)