cas: 979-88-4 — see every product listed under this CAS number, including other names
Sodium [2,2'-biquinoline]-4,4'-dicarboxylate, 98%, 98% (CAS 979-88-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147OP-1g |
| cas | 979-88-4 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 174.80 Pln | |
| Chemat | 50g | 280.40 Pln | |
| Chemat | 100g | 477.20 Pln | |
| Chemat | 250g | 1096.40 Pln | |
| Chemat | 500g | 2064.00 Pln | |
| Chemat | 1kg | 3496.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate (CAS 979-88-4) is a chemical compound with the molecular formula C20H10N2Na2O4 and a molecular weight of 388.3 g/mol. IUPAC name: disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate. InChIKey: AUPXFICLXPLHBB-UHFFFAOYSA-L.
| Molecular formula | C20H10N2Na2O4 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate |
| InChIKey | AUPXFICLXPLHBB-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=NC4=CC=CC=C4C(=C3)C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)