cas: 979-88-4 — see every product listed under this CAS number, including other names
BCA, 99.99% (CAS 979-88-4) is a chemical reagent available from Chemat. Available pack sizes: 1 kg, 25 g, 10mM/1mL, 100 g, 5 g, 500 g, 10 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-15908-1 kg |
| cas | 979-88-4 |
| size | 1 kg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 kg | 7030.27 Pln | |
| MedChemExpress | 25 g | 589.04 Pln | |
| MedChemExpress | 10mM/1mL | 277.90 Pln | |
| MedChemExpress | 100 g | 1346.02 Pln | |
| MedChemExpress | 5 g | 263.96 Pln | |
| MedChemExpress | 500 g | 4429.63 Pln | |
| MedChemExpress | 10 g | 352.20 Pln | |
| MedChemExpress | 50 g | 886.26 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.99% |
Disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate (CAS 979-88-4) is a chemical compound with the molecular formula C20H10N2Na2O4 and a molecular weight of 388.3 g/mol. IUPAC name: disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate. InChIKey: AUPXFICLXPLHBB-UHFFFAOYSA-L.
| Molecular formula | C20H10N2Na2O4 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate |
| InChIKey | AUPXFICLXPLHBB-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=NC4=CC=CC=C4C(=C3)C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)