cas: 979-88-4 — see every product listed under this CAS number, including other names
Bicinchoninic acid disodium salt hydrate, 98.00% (CAS 979-88-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM36160K-10g |
| cas | 979-88-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 589.25 Pln | |
| Chemat | 1g | 171.66 Pln | |
| Chemat | 25g | 1148.46 Pln | |
| Chemat | 5g | 360.49 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
Disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate (CAS 979-88-4) is a chemical compound with the molecular formula C20H10N2Na2O4 and a molecular weight of 388.3 g/mol. IUPAC name: disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate. InChIKey: AUPXFICLXPLHBB-UHFFFAOYSA-L.
| Molecular formula | C20H10N2Na2O4 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | disodium;2-(4-carboxylatoquinolin-2-yl)quinoline-4-carboxylate |
| InChIKey | AUPXFICLXPLHBB-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=NC4=CC=CC=C4C(=C3)C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)