Products 406190-85-0
CAS 406190-85-0 appears in our catalog under these names: BCAT-IN-4/ 99.29% (existing batch purity), BCAT-IN-4. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
N'-(benzenesulfonyl)dibenzofuran-2-carbohydrazide (CAS 406190-85-0) is a chemical compound with the molecular formula C19H14N2O4S and a molecular weight of 366.4 g/mol. IUPAC name: N'-(benzenesulfonyl)dibenzofuran-2-carbohydrazide. InChIKey: JAPUVWLLWGHBIY-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O4S |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | N'-(benzenesulfonyl)dibenzofuran-2-carbohydrazide |
| InChIKey | JAPUVWLLWGHBIY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NNC(=O)C2=CC3=C(C=C2)OC4=CC=CC=C43 |
Computed by PubChem (NCBI)