cas: 892686-59-8 — see every product listed under this CAS number, including other names
BD750 98% (CAS 892686-59-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1327318-50mg |
| cas | 892686-59-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 648.50 Pln | |
| Ambeed | 100mg | 932.19 Pln | |
| Ambeed | 250mg | 2228.25 Pln | |
| Ambeed | 1g | 6083.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1327318 |
2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one (CAS 892686-59-8) is a chemical compound with the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one. InChIKey: QWUHPPCZZXKXOQ-UHFFFAOYSA-N.
| Molecular formula | C14H13N3OS |
|---|---|
| Molecular weight | 271.34 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-4,5,6,7-tetrahydro-1H-indazol-3-one |
| InChIKey | QWUHPPCZZXKXOQ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)N(N2)C3=NC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)