cas: 76143-20-9 — see every product listed under this CAS number, including other names
BENZAMIDE, 5-FORMYL-2-HYDROXY-, 98% (CAS 76143-20-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F534867-100MG |
| cas | 76143-20-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 825.77 Pln | |
| Fluorochem | 250mg | 1164.19 Pln | |
| Fluorochem | 1g | 2601.19 Pln | |
| Fluorochem | 5g | 12774.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-formyl-2-hydroxybenzamide (CAS 76143-20-9) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 5-formyl-2-hydroxybenzamide. InChIKey: UIFAWCVGHFXLDS-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 5-formyl-2-hydroxybenzamide |
| InChIKey | UIFAWCVGHFXLDS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)C(=O)N)O |
Computed by PubChem (NCBI)