cas: 3006-60-8 — see every product listed under this CAS number, including other names
BETA-D-GALACTOSAMINE PENTAACETATE, 98%, 98% (CAS 3006-60-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143V1-250mg |
| cas | 3006-60-8 |
| size | 250mg |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 213.20 Pln | |
| Chemat | 50g | 362.00 Pln | |
| Chemat | 100g | 659.60 Pln | |
| Chemat | 250g | 1562.00 Pln | |
| Chemat | 500g | 2956.80 Pln | |
| Chemat | 1kg | 5766.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(2R,3R,4R,5R,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate (CAS 3006-60-8) is a chemical compound with the molecular formula C16H23NO10 and a molecular weight of 389.35 g/mol. IUPAC name: [(2R,3R,4R,5R,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate. InChIKey: OVPIZHVSWNOZMN-IBEHDNSVSA-N.
| Molecular formula | C16H23NO10 |
|---|---|
| Molecular weight | 389.35 g/mol |
| IUPAC name | [(2R,3R,4R,5R,6S)-5-acetamido-3,4,6-triacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | OVPIZHVSWNOZMN-IBEHDNSVSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@H]1OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)