cas: 96517-92-9 — see every product listed under this CAS number, including other names
BIS-PEG4-ACID, 97% (CAS 96517-92-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533615-100MG |
| cas | 96517-92-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 2.5g | 476.93 Pln | |
| Fluorochem | 5g | 841.39 Pln | |
| Fluorochem | 10g | 1622.36 Pln | |
| Fluorochem | 25g | 3038.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]propanoic acid (CAS 96517-92-9) is a chemical compound with the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. IUPAC name: 3-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]propanoic acid. InChIKey: WFLUHYUKINZPNZ-UHFFFAOYSA-N.
| Molecular formula | C10H18O7 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 3-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]propanoic acid |
| InChIKey | WFLUHYUKINZPNZ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)