Products 51433-28-4

CAS 51433-28-4 is the registry number for Methyl(methyl 3,4-di-O-methyl-α-D-glucopyranoside)uronate. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

Methyl 5-hydroxy-3,4,6-trimethoxyoxane-2-carboxylate (CAS 51433-28-4) is a chemical compound with the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. IUPAC name: methyl 5-hydroxy-3,4,6-trimethoxyoxane-2-carboxylate. InChIKey: RGVKHQPFTDKGNL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18O7
Molecular weight250.25 g/mol
IUPAC namemethyl 5-hydroxy-3,4,6-trimethoxyoxane-2-carboxylate
InChIKeyRGVKHQPFTDKGNL-UHFFFAOYSA-N
SMILESCOC1C(C(OC(C1OC)C(=O)OC)OC)O

Computed by PubChem (NCBI)