CAS 5391-15-1 appears in our catalog under these names: (2S,3S,4S,5R,6R)–3,4,5–trihydroxy–6–isobutoxytetrahydro–2H–pyran–2–carboxylic acid, Isobutyl β-D-glucuronide. Offered by: GLPBio, Chemat. Available pack sizes: 1mg, 10mg, 2mg, 5mg.
(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(2-methylpropoxy)oxane-2-carboxylic acid (CAS 5391-15-1) is a chemical compound with the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. IUPAC name: (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(2-methylpropoxy)oxane-2-carboxylic acid. InChIKey: BBLDJTVYNSHUPK-XWIWCORWSA-N.
| Molecular formula | C10H18O7 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(2-methylpropoxy)oxane-2-carboxylic acid |
| InChIKey | BBLDJTVYNSHUPK-XWIWCORWSA-N |
| SMILES | CC(C)CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)O)O)O)O |
Computed by PubChem (NCBI)