CAS 96517-92-9 appears in our catalog under these names: Bis-PEG3-acid, 97%, Bis–PEG3–acid, Bis-dPEG®,4-Acid, Bis-PEG3-acid 95%, 4,7,10-Trioxatridecanedioic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 1000mg, 25g, 10g, 50g.
3-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]propanoic acid (CAS 96517-92-9) is a chemical compound with the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. IUPAC name: 3-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]propanoic acid. InChIKey: WFLUHYUKINZPNZ-UHFFFAOYSA-N.
| Molecular formula | C10H18O7 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 3-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]propanoic acid |
| InChIKey | WFLUHYUKINZPNZ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)