Products 96517-92-9
CAS 96517-92-9 appears in our catalog under these names: Bis-PEG3-acid, 97%, Bis–PEG3–acid, Bis-dPEG®,4-Acid, Bis-PEG3-acid, 97.65%, Bis-PEG3-acid, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, MedChemExpress, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg, 1000mg, 5 g, 100 g, 10 g.
3-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]propanoic acid (CAS 96517-92-9) is a chemical compound with the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. IUPAC name: 3-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]propanoic acid. InChIKey: WFLUHYUKINZPNZ-UHFFFAOYSA-N.
| Molecular formula | C10H18O7 |
|---|---|
| Molecular weight | 250.25 g/mol |
| IUPAC name | 3-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]propanoic acid |
| InChIKey | WFLUHYUKINZPNZ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Bis-PEG3-acid, 3,3'-((Oxybis(ethane-2,1-diyl))bis(oxy))dipropanoic acid, Propanoic acid, 3,3'-[oxybis(2,1-ethanediyloxy)]bis-, 4,7,10-trioxatridecanedioic acid, 4,7,10-trioxa-tridecanedioic acid, 3-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]propanoic acid, 3,3'-((oxybis(ethane-2,1-diyl))bis(oxy))dipropionic acid, Bis-PEG3-COOH, 3,3'-[oxybis(ethane-2,1-diyloxy)]dipropanoic acid, orb1909499