cas: 403661-85-8 — see every product listed under this CAS number, including other names
BOC-(S)-3-AMINO-4-(4-TERT-BUTYL-PHENYL)-BUTYRIC ACID, 97% (CAS 403661-85-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F813290-100MG |
| cas | 403661-85-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 440.49 Pln | |
| Fluorochem | 1g | 1065.27 Pln | |
| Fluorochem | 5g | 3517.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-4-(4-tert-butylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 403661-85-8) is a chemical compound with the molecular formula C19H29NO4 and a molecular weight of 335.4 g/mol. IUPAC name: (3S)-4-(4-tert-butylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: VJXYUVJDZAIFHC-HNNXBMFYSA-N.
| Molecular formula | C19H29NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (3S)-4-(4-tert-butylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | VJXYUVJDZAIFHC-HNNXBMFYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)