cas: 122235-70-5 — see every product listed under this CAS number, including other names
BOC-DAP(Fmoc)-OH, 95% (CAS 122235-70-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F092725-1G |
| cas | 122235-70-5 |
| size | 1g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 206.20 Pln | |
| Fluorochem | 25g | 393.63 Pln | |
| Fluorochem | 100g | 1143.37 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 214.62 Pln | |
| Ambeed | 25g | 403.75 Pln | |
| Ambeed | 100g | 1104.63 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 122235-70-5) is a chemical compound with the molecular formula C23H26N2O6 and a molecular weight of 426.5 g/mol. IUPAC name: (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MVWPBNQGEGBGRF-IBGZPJMESA-N.
| Molecular formula | C23H26N2O6 |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | (2S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MVWPBNQGEGBGRF-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)