CAS 113760-29-5 appears in our catalog under these names: BOT–64, Nf-kb activation inhibitor vi, bot-64, 95%, 6,6–dimethyl–2–(phenylimino)–4,5,6,7–tetrahydro–2H–1,3–benzoxathiol–4–one, BOT-64/ 98.08% (existing batch purity), 6,6-Dimethyl-2-(phenylimino)-4,5,6,7-tetrahydro-2H-1,3-benzoxathiol-4-one. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 250mg, 100mg, 1mg, 10mg, 25mg, 50mg, 200mg.
6,6-dimethyl-2-phenylimino-5,7-dihydro-1,3-benzoxathiol-4-one (CAS 113760-29-5) is a chemical compound with the molecular formula C15H15NO2S and a molecular weight of 273.4 g/mol. IUPAC name: 6,6-dimethyl-2-phenylimino-5,7-dihydro-1,3-benzoxathiol-4-one. InChIKey: XFSSJIQCIPSBHJ-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2S |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | 6,6-dimethyl-2-phenylimino-5,7-dihydro-1,3-benzoxathiol-4-one |
| InChIKey | XFSSJIQCIPSBHJ-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)C1)SC(=NC3=CC=CC=C3)O2)C |
Computed by PubChem (NCBI)