cas: 1513879-21-4 — see every product listed under this CAS number, including other names
BQR-695 99% (CAS 1513879-21-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A725053-5mg |
| cas | 1513879-21-4 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 197.94 Pln | |
| Ambeed | 10mg | 264.69 Pln | |
| Ambeed | 25mg | 442.69 Pln | |
| Ambeed | 50mg | 698.56 Pln | |
| Ambeed | 100mg | 1071.25 Pln | |
| Ambeed | 250mg | 1761.00 Pln | |
| Ambeed | 1g | 4631.25 Pln | |
| Ambeed | 5g | 15322.38 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A725053 |
2-[[7-(3,4-dimethoxyphenyl)quinoxalin-2-yl]amino]-N-methylacetamide (CAS 1513879-21-4) is a chemical compound with the molecular formula C19H20N4O3 and a molecular weight of 352.4 g/mol. IUPAC name: 2-[[7-(3,4-dimethoxyphenyl)quinoxalin-2-yl]amino]-N-methylacetamide. InChIKey: LYPCULYCGFOIDA-UHFFFAOYSA-N.
| Molecular formula | C19H20N4O3 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 2-[[7-(3,4-dimethoxyphenyl)quinoxalin-2-yl]amino]-N-methylacetamide |
| InChIKey | LYPCULYCGFOIDA-UHFFFAOYSA-N |
| SMILES | CNC(=O)CNC1=CN=C2C=CC(=CC2=N1)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)