CAS 1422435-40-2 is the registry number for Dabigatran Impurity 74. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[(4-carbamoylanilino)methyl]-1-methylbenzimidazole-5-carboxylate (CAS 1422435-40-2) is a chemical compound with the molecular formula C19H20N4O3 and a molecular weight of 352.4 g/mol. IUPAC name: ethyl 2-[(4-carbamoylanilino)methyl]-1-methylbenzimidazole-5-carboxylate. InChIKey: YDONNPXUANLUMQ-UHFFFAOYSA-N.
| Molecular formula | C19H20N4O3 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | ethyl 2-[(4-carbamoylanilino)methyl]-1-methylbenzimidazole-5-carboxylate |
| InChIKey | YDONNPXUANLUMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N(C(=N2)CNC3=CC=C(C=C3)C(=O)N)C |
Computed by PubChem (NCBI)