CAS 1702936-92-2 appears in our catalog under these names: Dabigatran Impurity 55, DBG-1 Cyclised. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Ethyl 3-[(1-methylbenzimidazole-5-carbonyl)-pyridin-2-ylamino]propanoate (CAS 1702936-92-2) is a chemical compound with the molecular formula C19H20N4O3 and a molecular weight of 352.4 g/mol. IUPAC name: ethyl 3-[(1-methylbenzimidazole-5-carbonyl)-pyridin-2-ylamino]propanoate. InChIKey: PEQXDEDRNLSFNJ-UHFFFAOYSA-N.
| Molecular formula | C19H20N4O3 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | ethyl 3-[(1-methylbenzimidazole-5-carbonyl)-pyridin-2-ylamino]propanoate |
| InChIKey | PEQXDEDRNLSFNJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCN(C1=CC=CC=N1)C(=O)C2=CC3=C(C=C2)N(C=N3)C |
Computed by PubChem (NCBI)