cas: 1513879-21-4 — see every product listed under this CAS number, including other names
BQR-695, 99%, 99% (CAS 1513879-21-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EO05-1mg |
| cas | 1513879-21-4 |
| size | 1mg |
| availability | 15g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 131.60 Pln | |
| Chemat | 5mg | 146.00 Pln | |
| Chemat | 10mg | 203.60 Pln | |
| Chemat | 25mg | 347.60 Pln | |
| Chemat | 50mg | 544.40 Pln | |
| Chemat | 100mg | 880.40 Pln | |
| Chemat | 250mg | 1451.60 Pln | |
| Chemat | 1g | 4077.20 Pln | |
| Chemat | 5g | 11757.20 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-[[7-(3,4-dimethoxyphenyl)quinoxalin-2-yl]amino]-N-methylacetamide (CAS 1513879-21-4) is a chemical compound with the molecular formula C19H20N4O3 and a molecular weight of 352.4 g/mol. IUPAC name: 2-[[7-(3,4-dimethoxyphenyl)quinoxalin-2-yl]amino]-N-methylacetamide. InChIKey: LYPCULYCGFOIDA-UHFFFAOYSA-N.
| Molecular formula | C19H20N4O3 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 2-[[7-(3,4-dimethoxyphenyl)quinoxalin-2-yl]amino]-N-methylacetamide |
| InChIKey | LYPCULYCGFOIDA-UHFFFAOYSA-N |
| SMILES | CNC(=O)CNC1=CN=C2C=CC(=CC2=N1)C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)