Products 2490311-14-1
CAS 2490311-14-1 appears in our catalog under these names: BRD4 Inhibitor-20/ 100%, BRD4 Inhibitor–20, BRD4 Inhibitor-20 98%, 2-Methoxy-N-(2-oxo-3-(propan-2-ylidene)indolin-5-yl)benzenesulfonamide, 98%, 98%, BRD4 Inhibitor-20, 99.24%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
2-methoxy-N-(2-oxo-3-propan-2-ylidene-1H-indol-5-yl)benzenesulfonamide (CAS 2490311-14-1) is a chemical compound with the molecular formula C18H18N2O4S and a molecular weight of 358.4 g/mol. IUPAC name: 2-methoxy-N-(2-oxo-3-propan-2-ylidene-1H-indol-5-yl)benzenesulfonamide. InChIKey: CDERLIUJSXSXFH-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O4S |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 2-methoxy-N-(2-oxo-3-propan-2-ylidene-1H-indol-5-yl)benzenesulfonamide |
| InChIKey | CDERLIUJSXSXFH-UHFFFAOYSA-N |
| SMILES | CC(=C1C2=C(C=CC(=C2)NS(=O)(=O)C3=CC=CC=C3OC)NC1=O)C |
Computed by PubChem (NCBI)