cas: 5463-97-8 — see every product listed under this CAS number, including other names
Benzeneacetic acid, α-(1-hydroxycyclobutyl)-, 95%, 95% (CAS 5463-97-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12HZVM-100mg |
| cas | 5463-97-8 |
| size | 100mg |
| availability | 1.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 635.60 Pln | |
| Chemat | 1g | 1614.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(1-hydroxycyclobutyl)-2-phenylacetic acid (CAS 5463-97-8) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 2-(1-hydroxycyclobutyl)-2-phenylacetic acid. InChIKey: AAEQHELGUQCYGL-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 2-(1-hydroxycyclobutyl)-2-phenylacetic acid |
| InChIKey | AAEQHELGUQCYGL-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C(C2=CC=CC=C2)C(=O)O)O |
Computed by PubChem (NCBI)