Products 53568-17-5
CAS 53568-17-5 appears in our catalog under these names: 5–Methoxy–1，2，3，4–tetrahydronaphthalene–2–carboxylic acid, 5-Methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid, 95%, 5-Methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid 95%, 5-Methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (CAS 53568-17-5) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid. InChIKey: WYCIVOOAIQZDGE-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 5-methoxy-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| InChIKey | WYCIVOOAIQZDGE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1CCC(C2)C(=O)O |
Computed by PubChem (NCBI)